EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36N8O6 |
| Net Charge | 0 |
| Average Mass | 496.569 |
| Monoisotopic Mass | 496.27578 |
| SMILES | C[C@H](N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H36N8O6/c1-12(22)19(33)29-10-4-6-14(29)17(31)26-11-16(30)28-9-3-7-15(28)18(32)27-13(20(34)35)5-2-8-25-21(23)24/h12-15H,2-11,22H2,1H3,(H,26,31)(H,27,32)(H,34,35)(H4,23,24,25)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | ITZMJCSORYKOSI-AJNGGQMLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (10084574) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| APGPR Enterostatin (CHEBI:89430) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(2S)-1-(2-{[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]formamido}acetyl)pyrrolidin-2-yl]formamido}-5-[(diaminomethylidene)amino]pentanoic acid | HMDB |
| APGPR | HMDB |
| H-Ala-Pro-Gly-Pro-Arg-OH | HMDB |
| L-Alanyl-L-prolylglycyl-L-prolyl-L-Arginine | HMDB |
| N2-[1-[N-(1-L-alanyl-L-prolyl)glycyl]-L-prolyl] L-Arginine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Enterostatin | Wikipedia |
| HMDB0006117 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:117830-79-2 | KEGG COMPOUND |
| Citations |
|---|