EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H52O |
| Net Charge | 0 |
| Average Mass | 416.734 |
| Monoisotopic Mass | 416.40182 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@]([H])(C)CC[C@@H](CC)C(C)C)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21-,22+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | LGJMUZUPVCAVPU-HRJGVYIJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stigmastanol (CHEBI:89400) has parent hydride 5α-stigmastane (CHEBI:20658) |
| stigmastanol (CHEBI:89400) has role anticholesteremic drug (CHEBI:35821) |
| stigmastanol (CHEBI:89400) has role plant metabolite (CHEBI:76924) |
| stigmastanol (CHEBI:89400) is a 3-hydroxy steroid (CHEBI:36834) |
| stigmastanol (CHEBI:89400) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (5α)-stigmastan-3β-ol |
| Synonyms | Source |
|---|---|
| 24α-ethylcholestanol | ChemIDplus |
| (3β,5α,20S)-stigmastan-3-ol | IUPAC |
| (3β,5α)-stigmastan-3-ol | IUPAC |
| 5,6-dihydro-β-sitosterol | ChemIDplus |
| dihydrositosterin | ChemIDplus |
| fucostanol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00032163 | KNApSAcK |
| C19644 | KEGG COMPOUND |
| CPD-8481 | MetaCyc |
| HMDB0000494 | HMDB |
| LMST01040128 | LIPID MAPS |
| Stigmastanol | Wikipedia |
| Citations |
|---|