EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15FN2O4 |
| Net Charge | 0 |
| Average Mass | 354.337 |
| Monoisotopic Mass | 354.10159 |
| SMILES | C#CCN1C(=O)COc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C19H15FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9H,3-7,10H2 |
| InChIKey | FOUWCSDKDDHKQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumioxazin (CHEBI:8939) has role agrochemical (CHEBI:33286) |
| flumioxazin (CHEBI:8939) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| flumioxazin (CHEBI:8939) has role herbicide (CHEBI:24527) |
| flumioxazin (CHEBI:8939) has role teratogenic agent (CHEBI:50905) |
| flumioxazin (CHEBI:8939) is a benzoxazine (CHEBI:46969) |
| flumioxazin (CHEBI:8939) is a dicarboximide (CHEBI:35356) |
| flumioxazin (CHEBI:8939) is a organofluorine compound (CHEBI:37143) |
| flumioxazin (CHEBI:8939) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 2-[7-fluoro-3-oxo-4-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| 2-[7-fluoro-3,4-dihydro-3-oxo-4-(2-propyn-1-yl)-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | Alan Wood's Pesticides |
| 7-fluoro-6-(3,4,5,6-tetrahydrophthalimido)-4-(2-propynyl)-1,4-benzoxazin-3(2H)-one | ChemIDplus |
| N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide | Alan Wood's Pesticides |
| flumioxazine | ChEBI |
| S 53482 | ChemIDplus |
| S-53482 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Sumisoya | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 335 | PPDB |
| C11035 | KEGG COMPOUND |
| flumioxazin | Alan Wood's Pesticides |
| HMDB0034854 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8290535 | Reaxys |
| CAS:103361-09-7 | Alan Wood's Pesticides |
| CAS:103361-09-7 | KEGG COMPOUND |
| CAS:103361-09-7 | ChemIDplus |
| Citations |
|---|