EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15FN2O4 |
| Net Charge | 0 |
| Average Mass | 354.337 |
| Monoisotopic Mass | 354.10159 |
| SMILES | C#CCN1C(=O)COc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C19H15FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9H,3-7,10H2 |
| InChIKey | FOUWCSDKDDHKQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumioxazin (CHEBI:8939) has role agrochemical (CHEBI:33286) |
| flumioxazin (CHEBI:8939) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| flumioxazin (CHEBI:8939) has role herbicide (CHEBI:24527) |
| flumioxazin (CHEBI:8939) has role teratogenic agent (CHEBI:50905) |
| flumioxazin (CHEBI:8939) is a benzoxazine (CHEBI:46969) |
| flumioxazin (CHEBI:8939) is a dicarboximide (CHEBI:35356) |
| flumioxazin (CHEBI:8939) is a organofluorine compound (CHEBI:37143) |
| flumioxazin (CHEBI:8939) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 2-[7-fluoro-3-oxo-4-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| 2-[7-fluoro-3,4-dihydro-3-oxo-4-(2-propyn-1-yl)-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | Alan Wood's Pesticides |
| 7-fluoro-6-(3,4,5,6-tetrahydrophthalimido)-4-(2-propynyl)-1,4-benzoxazin-3(2H)-one | ChemIDplus |
| N-(7-fluoro-3,4-dihydro-3-oxo-4-prop-2-ynyl-2H-1,4-benzoxazin-6-yl)cyclohex-1-ene-1,2-dicarboxamide | Alan Wood's Pesticides |
| flumioxazine | ChEBI |
| S 53482 | ChemIDplus |
| S-53482 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Sumisoya | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 335 | PPDB |
| C11035 | KEGG COMPOUND |
| flumioxazin | Alan Wood's Pesticides |
| HMDB0034854 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8290535 | Reaxys |
| CAS:103361-09-7 | Alan Wood's Pesticides |
| CAS:103361-09-7 | KEGG COMPOUND |
| CAS:103361-09-7 | ChemIDplus |
| Citations |
|---|