EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O3 |
| Net Charge | 0 |
| Average Mass | 158.197 |
| Monoisotopic Mass | 158.09429 |
| SMILES | O=C(O)CC1CCC(O)CC1 |
| InChI | InChI=1S/C8H14O3/c9-7-3-1-6(2-4-7)5-8(10)11/h6-7,9H,1-5H2,(H,10,11) |
| InChIKey | ALTAAUJNHYWOGS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (24029555) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-Hydroxycyclohexylacetic acid (CHEBI:89344) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxycyclohexyl)acetic acid | HMDB |
| 4-Hydroxycyclohexylacetate | HMDB |
| 4-Hydroxy-cyclohexylessigsaeure | HMDB |
| cis-4-Hydroxycyclohexylacetate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000451 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:68592-22-3 | KEGG COMPOUND |
| Citations |
|---|