EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7BrO3S |
| Net Charge | 0 |
| Average Mass | 275.123 |
| Monoisotopic Mass | 273.92993 |
| SMILES | O=C(O)C(=O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H7BrO3S/c10-6-1-3-7(4-2-6)14-5-8(11)9(12)13/h1-4H,5H2,(H,12,13) |
| InChIKey | QJDFZNIKGFGPCR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) has functional parent bromobenzene (CHEBI:3179) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) has functional parent pyruvic acid (CHEBI:32816) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) is a aryl sulfide (CHEBI:35683) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) is a organobromine compound (CHEBI:37141) |
| (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) is conjugate acid of (4-bromophenylsulfanyl)pyruvate (CHEBI:17468) |
| Incoming Relation(s) |
| (4-bromophenylsulfanyl)pyruvate (CHEBI:17468) is conjugate base of (4-bromophenylsulfanyl)pyruvic acid (CHEBI:8934) |
| IUPAC Name |
|---|
| 3-[(4-bromophenyl)sulfanyl]-2-oxopropanoic acid |
| Synonym | Source |
|---|---|
| S-(4-bromophenyl)mercaptopyruvic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04264 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3286397 | Reaxys |