EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:89327 - 3-aminosalicylic acid
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C7H7NO3/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,9H,8H2,(H,10,11) |
| InChIKey | IQGMRVWUTCYCST-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (19309105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminosalicylic acid (CHEBI:89327) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| 3-Aminosalicylate | HMDB |
| 3-Amino-2-hydroxy-(9CI)benzoate | HMDB |
| 3-amino-2-hydroxybenzoic acid | HMDB |
| 3-Amino Salicylate | HMDB |
| Parasal | HMDB |
| 3-Amino-(8CI)salicylic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Paser | Wikipedia |
| HMDB0001972 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:570-23-0 | KEGG COMPOUND |
| Citations |
|---|