EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N3O3 |
| Net Charge | 0 |
| Average Mass | 231.296 |
| Monoisotopic Mass | 231.15829 |
| SMILES | NCCCCC(NC(=O)CCCN)C(=O)O |
| InChI | InChI=1S/C10H21N3O3/c11-6-2-1-4-8(10(15)16)13-9(14)5-3-7-12/h8H,1-7,11-12H2,(H,13,14)(H,15,16) |
| InChIKey | OCBQYJFUZHJRIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | cerebrospinal fluid (UBERON:0001359) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gamma-Aminobutyryl-lysine (CHEBI:89308) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| 6-amino-2-(4-aminobutanamido)hexanoic acid | HMDB |
| g-Aminobutyryl-lysine | HMDB |
| gamma-Aminobutyryl-lysine | HMDB |
| L-N2-(4-aminobutyryl)-Lysine | HMDB |
| N2-(4-aminobutyryl)-Lysine | HMDB |
| Na-(g-Aminobutyryl)-L-lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001959 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:22468-02-6 | KEGG COMPOUND |
| Citations |
|---|