EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8OS |
| Net Charge | 0 |
| Average Mass | 128.196 |
| Monoisotopic Mass | 128.02959 |
| SMILES | CSc1ccc(C)o1 |
| InChI | InChI=1S/C6H8OS/c1-5-3-4-6(7-5)8-2/h3-4H,1-2H3 |
| InChIKey | RESBOJMQOGJOMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (24023812) | ||
| - | PubMed (25123840) | Identified in human umbilical vein endothelial cells. | |
| - | PubMed (23870484) | Identified in human hepatocellular carcinoma cells. | |
| urine (BTO:0001419) | PubMed (30997581) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-5-(methylthio)furan (CHEBI:89286) has role flavouring agent (CHEBI:35617) |
| 2-methyl-5-(methylthio)furan (CHEBI:89286) has role human urinary metabolite (CHEBI:84087) |
| 2-methyl-5-(methylthio)furan (CHEBI:89286) has role plant metabolite (CHEBI:76924) |
| 2-methyl-5-(methylthio)furan (CHEBI:89286) is a furans (CHEBI:24129) |
| 2-methyl-5-(methylthio)furan (CHEBI:89286) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| 2-methyl-5-(methylsulfanyl)furan |
| Synonyms | Source |
|---|---|
| 5-methyl-2-(methylthio)furan | ChemIDplus |
| methyl 5-methylfuryl sulfide | ChemIDplus |
| 2-methyl 5-(methyl thio) furan | ChemIDplus |
| 2-methyl-5-methylthiofuran | ChemIDplus |
| FEMA 3366 | HMDB |
| 2-methyl-5-(methylthio)-furan | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041566 | HMDB |
| FDB021556 | FooDB |
| 55562 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13678-59-6 | ChemIDplus |
| CAS:13678-59-6 | NIST Chemistry WebBook |
| Citations |
|---|