EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | C=CCC(C)C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3,(H,7,8) |
| InChIKey | HVRZYSHVZOELOH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-4-pentenoic acid (CHEBI:89267) is a branched-chain fatty acid (CHEBI:35819) |
| Synonyms | Source |
|---|---|
| 2-Methylpent-4-en-1-oic acid | HMDB |
| 2-methylpent-4-enoic acid | HMDB |
| 2-Methylpent-4-enoic acid | HMDB |
| FEMA 3511 | HMDB |
| Methylallylacetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031158 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1575-74-2 | KEGG COMPOUND |