EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O2 |
| Net Charge | 0 |
| Average Mass | 242.403 |
| Monoisotopic Mass | 242.22458 |
| SMILES | CCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| InChIKey | ZAZKJZBWRNNLDS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (20809147) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl tetradecanoate (CHEBI:89199) has functional parent tetradecanoic acid (CHEBI:28875) |
| methyl tetradecanoate (CHEBI:89199) has role flavouring agent (CHEBI:35617) |
| methyl tetradecanoate (CHEBI:89199) has role fragrance (CHEBI:48318) |
| methyl tetradecanoate (CHEBI:89199) has role plant metabolite (CHEBI:76924) |
| methyl tetradecanoate (CHEBI:89199) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl tetradecanoate |
| Synonyms | Source |
|---|---|
| methyl myristate | ChemIDplus |
| methyl n-tetradecanoate | ChemIDplus |
| myristic acid methyl ester | ChemIDplus |
| myristic acid, methyl ester | ChemIDplus |
| tetradecanoic acid, methyl ester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Metholeneat 2495 | ChemIDplus |
| Uniphat A50 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00051572 | KNApSAcK |
| FDB002338 | FooDB |
| HMDB0030469 | HMDB |
| Citations |
|---|