EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O |
| Net Charge | 0 |
| Average Mass | 206.329 |
| Monoisotopic Mass | 206.16707 |
| SMILES | CC(C)(C)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22O/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | ICKWICRCANNIBI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (27524650) | |
| Ipomoea batatas (ncbitaxon:4120) | - | PubMed (24074359) | |
| Pseudomonas monteilii (ncbitaxon:76759) | - | PubMed (24934765) | Strain: PsF84 |
| Scolopendra subspinipes (ncbitaxon:55038) | - | PubMed (16595909) | |
| Streptomyces mutabilis (ncbitaxon:67332) | - | PubMed (27107984) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-di-tert-butylphenol (CHEBI:89188) has role antioxidant (CHEBI:22586) |
| 2,4-di-tert-butylphenol (CHEBI:89188) has role bacterial metabolite (CHEBI:76969) |
| 2,4-di-tert-butylphenol (CHEBI:89188) has role marine metabolite (CHEBI:76507) |
| 2,4-di-tert-butylphenol (CHEBI:89188) is a alkylbenzene (CHEBI:38976) |
| 2,4-di-tert-butylphenol (CHEBI:89188) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2,4-di-tert-butylbenzene | HMDB |
| 2,4-Bis(1,1-dimethylethyl)phenol | NIST Chemistry WebBook |
| 2,4-Bis(1,1-dimethylethyl)-Phenol | HMDB |
| 2,4-Bis(1,1'-dimethylethyl)phenol | HMDB |
| 2,4-Bis(tert-butyl)phenol | HMDB |
| 2,4-Di-t-Butylphenol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013816 | HMDB |
| Citations |
|---|