EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O2 |
| Net Charge | 0 |
| Average Mass | 220.312 |
| Monoisotopic Mass | 220.14633 |
| SMILES | CC(C)(C)C1=CC(=O)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H20O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | RDQSIADLBQFVMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (Zhang, S., Liu, L., Steffen, D., Ye, T., Raftery, D. (2012) Metabolic profiling of gender: Headspace-SPME/GC–MS and 1H NMR analysis of urine. Metabolomics 8:323–334.) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-Di-tert-butylbenzoquinone (CHEBI:89187) is a 1,4-benzoquinones (CHEBI:132124) |
| Synonyms | Source |
|---|---|
| 2,6-Bis(1,1-dimethylethyl)-2,5-Cyclohexadiene-1,4-dione | HMDB |
| 2,6-Bis(1, 1-Dimethylethyl)-2,5-cyclohexadiene-1,4-dione | HMDB |
| 2,6-Bis(1,1-Dimethylethyl)-2,5-cyclohexadiene-1,4-dione | HMDB |
| 2,6-Bis-(1,1-Dimethylethyl)-2,5-cycloxehadien-1,4-dione | HMDB |
| 2,6-Bis-tert-Butylbenzoquinone | HMDB |
| 2,6-Di-t-Butyl-p-benzoquinone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013817 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:719-22-2 | KEGG COMPOUND |