EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3 |
| InChIKey | FEYJIFXFOHFGCC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (Zhang, S., Liu, L., Steffen, D., Ye, T., Raftery, D. (2012) Metabolic profiling of gender: Headspace-SPME/GC–MS and 1H NMR analysis of urine. Metabolomics, 8, 323–334.) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-nitrohexane (CHEBI:89185) has parent hydride hexane (CHEBI:29021) |
| 1-nitrohexane (CHEBI:89185) has role human urinary metabolite (CHEBI:84087) |
| 1-nitrohexane (CHEBI:89185) is a primary nitroalkane (CHEBI:133972) |
| IUPAC Name |
|---|
| 1-nitrohexane |
| Synonyms | Source |
|---|---|
| 1-nitro-hexane | ChEBI |
| nitrohexane | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013812 | HMDB |
| CPD-8146 | MetaCyc |
| N6C | PDBeChem |
| Citations |
|---|