EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO4 |
| Net Charge | 0 |
| Average Mass | 323.348 |
| Monoisotopic Mass | 323.11576 |
| SMILES | [H]C1(C2(C)CO2)Cc2c(cc(O)c3c(=O)c4ccccc4n(C)c23)O1 |
| InChI | InChI=1S/C19H17NO4/c1-19(9-23-19)15-7-11-14(24-15)8-13(21)16-17(11)20(2)12-6-4-3-5-10(12)18(16)22/h3-6,8,15,21H,7,9H2,1-2H3 |
| InChIKey | YXQGLAPCZDYVLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rutacridone epoxide (CHEBI:8918) has functional parent acridone (CHEBI:50756) |
| Rutacridone epoxide (CHEBI:8918) is a acridines (CHEBI:22213) |
| Rutacridone epoxide (CHEBI:8918) is a alkaloid antibiotic (CHEBI:86322) |
| Synonym | Source |
|---|---|
| Rutacridone epoxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10739 | KEGG COMPOUND |
| C00002197 | KNApSAcK |
| HMDB0033853 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77996-03-3 | KEGG COMPOUND |