EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CCCCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3 |
| InChIKey | UZONFOPDCXAZND-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (Zhang, S., Liu, L., Steffen, D., Ye, T., Raftery, D. (2012) Metabolic profiling of gender: Headspace-SPME/GC–MS and 1H NMR analysis of urine. Metabolomics, 8, 323–334.) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-nitroheptane (CHEBI:89173) has parent hydride heptane (CHEBI:43098) |
| 1-nitroheptane (CHEBI:89173) has role human urinary metabolite (CHEBI:84087) |
| 1-nitroheptane (CHEBI:89173) is a primary nitroalkane (CHEBI:133972) |
| IUPAC Name |
|---|
| 1-nitroheptane |
| Synonyms | Source |
|---|---|
| 1-nitro-heptane | ChEBI |
| nitroheptane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013811 | HMDB |
| Citations |
|---|