EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18FN3O3S |
| Net Charge | 0 |
| Average Mass | 363.414 |
| Monoisotopic Mass | 363.10529 |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2SCC4)CC1 |
| InChI | InChI=1S/C17H18FN3O3S/c1-19-2-4-20(5-3-19)14-12(18)8-10-13-16(14)25-7-6-21(13)9-11(15(10)22)17(23)24/h8-9H,2-7H2,1H3,(H,23,24) |
| InChIKey | NJCJBUHJQLFDSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rufloxacin (CHEBI:8909) is a fluoroquinolone antibiotic (CHEBI:87211) |
| Rufloxacin (CHEBI:8909) is a quinolines (CHEBI:26513) |
| Rufloxacin (CHEBI:8909) is a quinolone antibiotic (CHEBI:86324) |
| Synonyms | Source |
|---|---|
| MF-934 | DrugCentral |
| Rufloxacin | KEGG COMPOUND |
| rufloxacin hydrobromide | DrugCentral |
| rufloxacin hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2412 | DrugCentral |
| C11240 | KEGG COMPOUND |
| D02474 | KEGG DRUG |
| HMDB0042009 | HMDB |
| LSM-5715 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:101363-10-4 | KEGG COMPOUND |