EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O |
| Net Charge | 0 |
| Average Mass | 96.129 |
| Monoisotopic Mass | 96.05751 |
| SMILES | Cc1ccc(C)o1 |
| InChI | InChI=1S/C6H8O/c1-5-3-4-6(2)7-5/h3-4H,1-2H3 |
| InChIKey | GSNUFIFRDBKVIE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium cepa (ncbitaxon:4679) | - | DOI (10.1021/jf60177a031) | Detected in onions but not isolated. |
| Burkholderia gladioli (ncbitaxon:28095) | - | PubMed (33572680) | Strain: BBB-01 |
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | Article (National Health and Nutrition Examination Survey (NHANES Survey) 2013) | ||
| faeces (UBERON:0001988) | PubMed (19167006) | ||
| urine (BTO:0001419) | PubMed (22284503) |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | fumigant A volatile or volatilizable chemical compound utilized for control of pests in buildings, soil, grain, as well as during processing of goods to be imported or exported to prevent transfer of exotic organisms. fuel An energy-rich substance that can be transformed with release of usable energy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dimethylfuran (CHEBI:89052) has role antifungal agent (CHEBI:35718) |
| 2,5-dimethylfuran (CHEBI:89052) has role bacterial metabolite (CHEBI:76969) |
| 2,5-dimethylfuran (CHEBI:89052) has role fuel (CHEBI:33292) |
| 2,5-dimethylfuran (CHEBI:89052) has role fumigant (CHEBI:39276) |
| 2,5-dimethylfuran (CHEBI:89052) has role human urinary metabolite (CHEBI:84087) |
| 2,5-dimethylfuran (CHEBI:89052) has role Maillard reaction product (CHEBI:77523) |
| 2,5-dimethylfuran (CHEBI:89052) has role plant metabolite (CHEBI:76924) |
| 2,5-dimethylfuran (CHEBI:89052) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 2,5-dimethylfuran |
| Synonyms | Source |
|---|---|
| 2,5-dimethyl-furan | HMDB |
| 2,5-dimethylfurane | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 11763 | ChemSpider |
| 2,5-Dimethylfuran | Wikipedia |
| FDB011193 | FooDB |
| HMDB0033182 | HMDB |
| Citations |
|---|