EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32N4O2 |
| Net Charge | 0 |
| Average Mass | 492.623 |
| Monoisotopic Mass | 492.25253 |
| SMILES | [H][C@@]12CN3CCc4c(nc5ccccc45)[C@@]3([H])C[C@]1([H])C(C(=O)OC)=CN1CCc3c(nc4ccccc34)[C@]12C |
| InChI | InChI=1S/C31H32N4O2/c1-31-24-17-34-13-11-20-18-7-3-5-9-25(18)32-28(20)27(34)15-22(24)23(30(36)37-2)16-35(31)14-12-21-19-8-4-6-10-26(19)33-29(21)31/h3-10,16,22,24,27,32-33H,11-15,17H2,1-2H3/t22-,24-,27-,31-/m1/s1 |
| InChIKey | SHKMVIVFLHPOSB-TVRWTGHXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roxburghine B (CHEBI:8903) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Roxburghine B | KEGG COMPOUND |