EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O8 |
| Net Charge | 0 |
| Average Mass | 516.546 |
| Monoisotopic Mass | 516.17842 |
| SMILES | CC(=O)c1c(O)c(C)c(O)c(Cc2c(O)c3c(c(C(=O)/C=C/c4ccccc4)c2O)OC(C)(C)C=C3)c1O |
| InChI | InChI=1S/C30H28O8/c1-15-24(33)19(27(36)22(16(2)31)25(15)34)14-20-26(35)18-12-13-30(3,4)38-29(18)23(28(20)37)21(32)11-10-17-8-6-5-7-9-17/h5-13,33-37H,14H2,1-4H3/b11-10+ |
| InChIKey | DEZFNHCVIZBHBI-ZHACJKMWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. K-ATP channel agonist A compound which acts as an agonist at the ATP-sensitive K+ channel. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rottlerin (CHEBI:8899) has role anti-allergic agent (CHEBI:50857) |
| rottlerin (CHEBI:8899) has role antihypertensive agent (CHEBI:35674) |
| rottlerin (CHEBI:8899) has role antineoplastic agent (CHEBI:35610) |
| rottlerin (CHEBI:8899) has role apoptosis inducer (CHEBI:68495) |
| rottlerin (CHEBI:8899) has role K-ATP channel agonist (CHEBI:64338) |
| rottlerin (CHEBI:8899) has role metabolite (CHEBI:25212) |
| rottlerin (CHEBI:8899) is a aromatic ketone (CHEBI:76224) |
| rottlerin (CHEBI:8899) is a benzenetriol (CHEBI:22707) |
| rottlerin (CHEBI:8899) is a chromenol (CHEBI:39436) |
| rottlerin (CHEBI:8899) is a enone (CHEBI:51689) |
| rottlerin (CHEBI:8899) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| (2E)-1-[6-(3-acetyl-2,4,6-trihydroxy-5-methylbenzyl)-5,7-dihydroxy-2,2-dimethyl-2H-chromen-8-yl]-3-phenylprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 3'-((8-cinnamoyl-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)methyl)-2',4',6'-trihydroxy-5'-methyl-acetophenone | ChEBI |
| Kamalin | ChemIDplus |
| Mallotoxin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10721 | KEGG COMPOUND |
| US2011112182 | Patent |
| EP2578210 | Patent |
| LMPK12120428 | LIPID MAPS |
| Rottlerin | Wikipedia |
| C00002708 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:70757 | Reaxys |
| CAS:82-08-6 | KEGG COMPOUND |
| CAS:82-08-6 | ChemIDplus |
| Citations |
|---|