EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O8 |
| Net Charge | 0 |
| Average Mass | 516.546 |
| Monoisotopic Mass | 516.17842 |
| SMILES | CC(=O)c1c(O)c(C)c(O)c(Cc2c(O)c3c(c(C(=O)/C=C/c4ccccc4)c2O)OC(C)(C)C=C3)c1O |
| InChI | InChI=1S/C30H28O8/c1-15-24(33)19(27(36)22(16(2)31)25(15)34)14-20-26(35)18-12-13-30(3,4)38-29(18)23(28(20)37)21(32)11-10-17-8-6-5-7-9-17/h5-13,33-37H,14H2,1-4H3/b11-10+ |
| InChIKey | DEZFNHCVIZBHBI-ZHACJKMWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | K-ATP channel agonist A compound which acts as an agonist at the ATP-sensitive K+ channel. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rottlerin (CHEBI:8899) has role anti-allergic agent (CHEBI:50857) |
| rottlerin (CHEBI:8899) has role antihypertensive agent (CHEBI:35674) |
| rottlerin (CHEBI:8899) has role antineoplastic agent (CHEBI:35610) |
| rottlerin (CHEBI:8899) has role apoptosis inducer (CHEBI:68495) |
| rottlerin (CHEBI:8899) has role K-ATP channel agonist (CHEBI:64338) |
| rottlerin (CHEBI:8899) has role metabolite (CHEBI:25212) |
| rottlerin (CHEBI:8899) is a aromatic ketone (CHEBI:76224) |
| rottlerin (CHEBI:8899) is a benzenetriol (CHEBI:22707) |
| rottlerin (CHEBI:8899) is a chromenol (CHEBI:39436) |
| rottlerin (CHEBI:8899) is a enone (CHEBI:51689) |
| rottlerin (CHEBI:8899) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| (2E)-1-[6-(3-acetyl-2,4,6-trihydroxy-5-methylbenzyl)-5,7-dihydroxy-2,2-dimethyl-2H-chromen-8-yl]-3-phenylprop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 3'-((8-cinnamoyl-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)methyl)-2',4',6'-trihydroxy-5'-methyl-acetophenone | ChEBI |
| Kamalin | ChemIDplus |
| Mallotoxin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002708 | KNApSAcK |
| C10721 | KEGG COMPOUND |
| EP2578210 | Patent |
| LMPK12120428 | LIPID MAPS |
| Rottlerin | Wikipedia |
| US2011112182 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:70757 | Reaxys |
| CAS:82-08-6 | KEGG COMPOUND |
| CAS:82-08-6 | ChemIDplus |
| Citations |
|---|