EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O5 |
| Net Charge | 0 |
| Average Mass | 257.246 |
| Monoisotopic Mass | 257.10117 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C10H15N3O5/c11-7(14)3-1-6(10(17)18)13-9(16)5-2-4-8(15)12-5/h5-6H,1-4H2,(H2,11,14)(H,12,15)(H,13,16)(H,17,18)/t5-,6-/m0/s1 |
| InChIKey | ILAITOFTZJRIFJ-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (22308371) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyroglutamylglutamine (CHEBI:88956) has role human metabolite (CHEBI:77746) |
| pyroglutamylglutamine (CHEBI:88956) is a dipeptide (CHEBI:46761) |
| pyroglutamylglutamine (CHEBI:88956) is conjugate acid of pyroglutamylglutaminate (CHEBI:133739) |
| Incoming Relation(s) |
| pyroglutamylglutaminate (CHEBI:133739) is conjugate base of pyroglutamylglutamine (CHEBI:88956) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-glutamine |
| Synonyms | Source |
|---|---|
| 5-oxoprolylglutamine | ChEBI |
| p-Glu-Gln | ChEBI |
| Pyro-L-glutaminyl-L-glutamine | HMDB |
| L-p-Glu-L-Gln | ChEBI |
| L-pyroglutamyl-L-glutamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039229 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90754 | Reaxys |
| Citations |
|---|