EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | C[C@@H]1c2cc(O)c(O)cc2CCN1C |
| InChI | InChI=1S/C11H15NO2/c1-7-9-6-11(14)10(13)5-8(9)3-4-12(7)2/h5-7,13-14H,3-4H2,1-2H3/t7-/m1/s1 |
| InChIKey | RKMGOUZXGHZLBJ-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | cerebrospinal fluid (UBERON:0001359) | PubMed (14978525) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-N-Methylsalsolinol (CHEBI:88955) has functional parent (R)-salsolinol (CHEBI:88801) |
| (R)-N-Methylsalsolinol (CHEBI:88955) is a isoquinolines (CHEBI:24922) |
| (R)-N-Methylsalsolinol (CHEBI:88955) is conjugate base of (R)-N-methylsalsolinol(1+) (CHEBI:194083) |
| Incoming Relation(s) |
| (R)-N-methylsalsolinol(1+) (CHEBI:194083) is conjugate acid of (R)-N-Methylsalsolinol (CHEBI:88955) |
| Synonyms | Source |
|---|---|
| N-Methyl-(R)-salsolinol | HMDB |
| (1R)-1,2-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003626 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53622-84-7 | KEGG COMPOUND |
| Citations |
|---|