EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88950 - 3-Oxoglutaric acid
| Formula | C5H6O5 |
| Net Charge | 0 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02152 |
| SMILES | O=C(O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C5H6O5/c6-3(1-4(7)8)2-5(9)10/h1-2H2,(H,7,8)(H,9,10) |
| InChIKey | OXTNCQMOKLOUAM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22372404) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Oxoglutaric acid (CHEBI:88950) is a oxo carboxylic acid (CHEBI:25754) |
| 3-Oxoglutaric acid (CHEBI:88950) is conjugate acid of 3-oxoglutarate(2−) (CHEBI:234323) |
| Incoming Relation(s) |
| 3-oxoglutarate(2−) (CHEBI:234323) is conjugate base of 3-Oxoglutaric acid (CHEBI:88950) |
| IUPAC Name |
|---|
| 3-oxopentanedioic acid |
| Synonym | Source |
|---|---|
| b-Ketoglutaric Acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3-oxoglutaric_acid | Wikipedia |
| HMDB0013701 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:542-05-2 | KEGG COMPOUND |
| Citations |
|---|