EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40N8O6 |
| Net Charge | 0 |
| Average Mass | 500.601 |
| Monoisotopic Mass | 500.30708 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)NC(CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13?,14+,15+,16+/m1/s1 |
| InChIKey | IESDGNYHXIOKRW-NNFXCFJSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (11586436) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tuftsin (CHEBI:88947) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(2S)-1-{6-amino-2-[(2S,3R)-2-amino-3-hydroxybutanamido]hexanoyl}pyrrolidin-2-yl]formamido}-5-carbamimidamidopentanoic acid | HMDB |
| L-Threonyl-L-LYSYL-L-prolyl-L-arginine | HMDB |
| Polytuftsin | HMDB |
| Tuftsin polymer | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005770 | HMDB |
| Tuftsin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:112592-90-2 | KEGG COMPOUND |
| Citations |
|---|