EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15O6 |
| Net Charge | +1 |
| Average Mass | 315.301 |
| Monoisotopic Mass | 315.08631 |
| SMILES | COc1cc(O)c2cc(O)c(-c3ccc(O)c(OC)c3)[o+]c2c1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-6-13(19)11-8-14(20)17(23-15(11)7-10)9-3-4-12(18)16(5-9)22-2/h3-8H,1-2H3,(H2-,18,19,20)/p+1 |
| InChIKey | GNONHFYAESLOCB-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosinidin (CHEBI:8893) has role plant metabolite (CHEBI:76924) |
| rosinidin (CHEBI:8893) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-1-benzopyran-1-ium |
| Manual Xrefs | Databases |
|---|---|
| C08729 | KEGG COMPOUND |
| C00006615 | KNApSAcK |
| LMPK12010417 | LIPID MAPS |
| Rosinidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1662539 | Reaxys |
| CAS:4092-64-2 | KEGG COMPOUND |
| Citations |
|---|