EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O.HCl |
| Net Charge | 0 |
| Average Mass | 296.842 |
| Monoisotopic Mass | 296.16554 |
| SMILES | CCCN(CCC)CCc1cccc2c1CC(=O)N2.Cl |
| InChI | InChI=1S/C16H24N2O.ClH/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15;/h5-7H,3-4,8-12H2,1-2H3,(H,17,19);1H |
| InChIKey | XDXHAEQXIBQUEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ropinirole hydrochloride (CHEBI:8889) has role antiparkinson drug (CHEBI:48407) |
| Ropinirole hydrochloride (CHEBI:8889) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Requip | KEGG COMPOUND |
| Ropinirole (as hydrochloride) | ChEMBL |
| Ropinirole hydrochloride | KEGG COMPOUND |
| SK&F 101468-A | ChEMBL |
| SK&F-101468-A | ChEMBL |
| Brand Names | Source |
|---|---|
| Adartrel | ChEMBL |
| Aimpart xl | ChEMBL |
| Clevor | ChEMBL |
| Ipinnia xl | ChEMBL |
| Ralnea xl | ChEMBL |
| Raponer xl | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00784 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:91374-20-8 | KEGG COMPOUND |
| Citations |
|---|