EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O |
| Net Charge | 0 |
| Average Mass | 260.381 |
| Monoisotopic Mass | 260.18886 |
| SMILES | CCCN(CCC)CCc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C16H24N2O/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15/h5-7H,3-4,8-12H2,1-2H3,(H,17,19) |
| InChIKey | UHSKFQJFRQCDBE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. dopamine agonist A drug that binds to and activates dopamine receptors. antiparkinson drug A drug used in the treatment of Parkinson's disease. central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ropinirole (CHEBI:8888) has role antidyskinesia agent (CHEBI:66956) |
| ropinirole (CHEBI:8888) has role antiparkinson drug (CHEBI:48407) |
| ropinirole (CHEBI:8888) has role central nervous system drug (CHEBI:35470) |
| ropinirole (CHEBI:8888) has role dopamine agonist (CHEBI:51065) |
| ropinirole (CHEBI:8888) is a indolones (CHEBI:24829) |
| ropinirole (CHEBI:8888) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 4-[2-(dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one |
| INNs | Source |
|---|---|
| ropinirol | WHO MedNet |
| ropinirole | ChemIDplus |
| ropinirole | WHO MedNet |
| ropinirolum | WHO MedNet |
| Synonym | Source |
|---|---|
| Ropinirole | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6062222 | Beilstein |
| CAS:91374-21-9 | ChemIDplus |