EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H43N |
| Net Charge | 0 |
| Average Mass | 393.659 |
| Monoisotopic Mass | 393.33955 |
| SMILES | CCCCCCCCc1ccc(Nc2ccc(CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H43N/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)29-28-23-19-26(20-24-28)16-14-12-10-8-6-4-2/h17-24,29H,3-16H2,1-2H3 |
| InChIKey | QAPVYZRWKDXNDK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| P,P-Dioctyldiphenylamine (CHEBI:88866) is a substituted aniline (CHEBI:48975) |
| Synonym | Source |
|---|---|
| 4-octyl-N-(4-octylphenyl)aniline | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061926 | HMDB |