EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | CC(C)=C1C=CC(C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,9H,5,7H2,1-3H3 |
| InChIKey | CIPXOBMYVWRNLL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anethum foeniculum subsp. piperitum (ncbitaxon:732956) | - | PubMed (33681616) | |
| Annona muricata (ncbitaxon:13337) | - | PubMed (22989376) | |
| Crithmum maritimum (ncbitaxon:40916) | - | PubMed (11371010) | |
| Elwendia persica (ncbitaxon:377494) | seed (PO:0009010) | PubMed (31497509) | Species also known as Bunium persicum. |
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) | |
| Parasenecio hastatus var. orientalis (ncbitaxon:2837480) | - | PubMed (20877145) | Species also known as Cacalia hastata var. orientalis. |
| Salvadora persica (ncbitaxon:4326) | leaf (BTO:0000713) | PubMed (12737403) | |
| Schinus terebinthifolia (ncbitaxon:169191) | - | PubMed (20799936) | |
| Vitex agnus-castus (ncbitaxon:54477) | leaf (BTO:0000713) | PubMed (30186986) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoterpinolene (CHEBI:88840) has role human metabolite (CHEBI:77746) |
| isoterpinolene (CHEBI:88840) has role plant metabolite (CHEBI:76924) |
| isoterpinolene (CHEBI:88840) is a p-menthadiene (CHEBI:50073) |
| isoterpinolene (CHEBI:88840) is a cycloalkene (CHEBI:33643) |
| IUPAC Name |
|---|
| 3-methyl-6-(propan-2-ylidene)cyclohexene |
| Synonyms | Source |
|---|---|
| 2,4(8)-p-menthadiene | ChemIDplus |
| 3-isopropylidene-6-methyl-cyclohexene | NIST Chemistry WebBook |
| 3-methyl-6-(1-methylethylidene)cyclohexene | ChemIDplus |
| 3-methyl-6-(propan-2-ylidene)cyclohex-1-ene | IUPAC |
| para-mentha-2,4(8)-diene | NIST Chemistry WebBook |
| p-mentha-2,4(8)-diene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| isoterpinolene | UniProt |
| Citations |
|---|