EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO5 |
| Net Charge | 0 |
| Average Mass | 231.248 |
| Monoisotopic Mass | 231.11067 |
| SMILES | O=C(O)CCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C10H17NO5/c12-8(11-7-10(15)16)5-3-1-2-4-6-9(13)14/h1-7H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | HXATVKDSYDWTCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2026685) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Suberylglycine (CHEBI:88811) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| 7-[(carboxymethyl)carbamoyl]heptanoic acid | HMDB |
| Suberylglycin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000953 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:60317-54-6 | KEGG COMPOUND |
| Citations |
|---|