EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | CCCC(=O)OC |
| InChI | InChI=1S/C5H10O2/c1-3-4-5(6)7-2/h3-4H2,1-2H3 |
| InChIKey | UUIQMZJEGPQKFD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (23454028) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl butyrate (CHEBI:88806) is a fatty acid ester (CHEBI:35748) |
| Synonyms | Source |
|---|---|
| Butanoic acid, methyl ester | HMDB |
| Butyric acid, methyl ester | HMDB |
| methyl butanoate | HMDB |
| Methyl butanoate | HMDB |
| Methyl ester of butanoic acid | HMDB |
| Methyl N-butanoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033890 | HMDB |
| Methyl_butyrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:623-42-7 | KEGG COMPOUND |
| Citations |
|---|