EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N7O11 |
| Net Charge | 0 |
| Average Mass | 609.593 |
| Monoisotopic Mass | 609.23945 |
| SMILES | C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H35N7O11/c1-11(21(38)32-17(25(42)43)10-20(36)37)29-23(40)16(9-19(28)35)31-24(41)15(8-12-2-4-13(33)5-3-12)30-22(39)14(26)6-7-18(27)34/h2-5,11,14-17,33H,6-10,26H2,1H3,(H2,27,34)(H2,28,35)(H,29,40)(H,30,39)(H,31,41)(H,32,38)(H,36,37)(H,42,43)/t11-,14-,15-,16-,17-/m0/s1 |
| InChIKey | WKBAPRRMZYHPNB-BXBUPLCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | cerebrospinal fluid (UBERON:0001359) | PubMed (11293697) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| QYNAD (CHEBI:88777) is a pentapeptide (CHEBI:48545) |
| Synonyms | Source |
|---|---|
| (2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-amino-4-carbamoylbutanamido]-3-(4-hydroxyphenyl)propanamido]-3-carbamoylpropanamido]propanamido]butanedioic acid | HMDB |
| L-Glutaminyl-L-tyrosyl-L-asparaginyl-L-alanyl-L-Aspartic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006730 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:290814-98-1 | KEGG COMPOUND |
| Citations |
|---|