EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25NO5 |
| Net Charge | 0 |
| Average Mass | 275.345 |
| Monoisotopic Mass | 275.17327 |
| SMILES | CCCC(O)CC(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C13H25NO5/c1-5-6-10(15)7-13(18)19-11(8-12(16)17)9-14(2,3)4/h10-11,15H,5-9H2,1-4H3/t10?,11-/m0/s1 |
| InChIKey | VYEONLJQPYRKAN-DTIOYNMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyhexanoylcarnitine (CHEBI:88772) is a O-acylcarnitine (CHEBI:17387) |
| IUPAC Name |
|---|
| (3S)-3-[(3-hydroxyhexanoyl)oxy]-4-(trimethylazaniumyl)butanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013131 | HMDB |