EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O3 |
| Net Charge | 0 |
| Average Mass | 168.152 |
| Monoisotopic Mass | 168.05349 |
| SMILES | Nc1ccc(O)c(C(=O)O)c1N |
| InChI | InChI=1S/C7H8N2O3/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2,10H,8-9H2,(H,11,12) |
| InChIKey | CGKSFNAGRBJNJO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (19309105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Diaminosalicylic acid (CHEBI:88769) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonym | Source |
|---|---|
| 2,3-diamino-6-hydroxybenzoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013159 | HMDB |
| Citations |
|---|