EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2 |
| Net Charge | 0 |
| Average Mass | 116.160 |
| Monoisotopic Mass | 116.08373 |
| SMILES | CCCC(=O)OCC |
| InChI | InChI=1S/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 |
| InChIKey | OBNCKNCVKJNDBV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus sinensis (ncbitaxon:2711) | fruit (BTO:0000486) | PubMed (28285516) | |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (19167006) | |
| Mangifera indica (ncbitaxon:29780) | ripe fruit (PO:0007038) | PubMed (27167034) | |
| Passiflora edulis (ncbitaxon:78168) | fruit (BTO:0000486) | PubMed (28740317) | |
| Physalis peruviana (ncbitaxon:126903) | fruit (BTO:0000486) | PubMed (27440155) | |
| Ribes nigrum (ncbitaxon:78511) | fruit (BTO:0000486) | PubMed (28992408) | |
| Solanum betaceum (ncbitaxon:45843) | fruit (BTO:0000486) | PubMed (27999263) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl butyrate (CHEBI:88764) has functional parent ethanol (CHEBI:16236) |
| ethyl butyrate (CHEBI:88764) has role plant metabolite (CHEBI:76924) |
| ethyl butyrate (CHEBI:88764) is a butyrate ester (CHEBI:50477) |
| IUPAC Name |
|---|
| ethyl butanoate |
| Synonyms | Source |
|---|---|
| Butanoic acid ethyl ester | HMDB |
| Butyric acid ethyl ester | HMDB |
| Ethyl 1-butyrate | HMDB |
| Ethyl ester of butanoic acid | HMDB |
| Ethyl n-butanoate | NIST Chemistry WebBook |
| Ethyl n-butyrate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethyl butanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00050446 | KNApSAcK |
| Ethyl_butyrate | Wikipedia |
| HMDB0033889 | HMDB |
| US6153246 | Patent |
| Citations |
|---|