EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O7 |
| Net Charge | 0 |
| Average Mass | 302.238 |
| Monoisotopic Mass | 302.04265 |
| SMILES | O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O7/c16-7-1-2-8-11(5-7)22-15(14(21)12(8)19)6-3-9(17)13(20)10(18)4-6/h1-5,16-18,20-21H |
| InChIKey | SOEDEYVDCDYMMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Intsia palembanica (ncbitaxon:576999) | - | DOI (10.1007/s10086-013-1388-5) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| robinetin (CHEBI:8876) has role plant metabolite (CHEBI:76924) |
| robinetin (CHEBI:8876) is a 7-hydroxyflavonol (CHEBI:52267) |
| robinetin (CHEBI:8876) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5-Deoxymyricetin | KEGG COMPOUND |
| 5-Hydroxyfisetin | ChemIDplus |
| Citations |
|---|