EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88742 - Gentisuric acid
| Formula | C9H9NO5 |
| Net Charge | 0 |
| Average Mass | 211.173 |
| Monoisotopic Mass | 211.04807 |
| SMILES | O=C(O)CNC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H9NO5/c11-5-1-2-7(12)6(3-5)9(15)10-4-8(13)14/h1-3,11-12H,4H2,(H,10,15)(H,13,14) |
| InChIKey | FBFATOOJCPDQOZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (417892) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gentisuric acid (CHEBI:88742) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| n-(2,5-dihydroxybenzoyl)glycine | HMDB |
| 2-[(2,5-dihydroxybenzoyl)amino]acetic acid | HMDB |
| 2-[(2,5-dihydroxyphenyl)formamido]acetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059999 | HMDB |
| Citations |
|---|