EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O12S |
| Net Charge | 0 |
| Average Mass | 544.575 |
| Monoisotopic Mass | 544.16145 |
| SMILES | [H][C@@]12CCc3cc(OS(=O)(=O)O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H](OC3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)C[C@@]21[H] |
| InChI | InChI=1S/C24H32O12S/c1-24-7-6-13-12-5-3-11(36-37(31,32)33)8-10(12)2-4-14(13)15(24)9-16(21(24)28)34-23-19(27)17(25)18(26)20(35-23)22(29)30/h3,5,8,13-21,23,25-28H,2,4,6-7,9H2,1H3,(H,29,30)(H,31,32,33)/t13-,14-,15+,16-,17+,18+,19-,20+,21+,23?,24+/m1/s1 |
| InChIKey | ATNWFRGUDKUYOG-SUPAOECSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| amniotic fluid (BTO:0000068) | PubMed (2994907) | ||
| urine (BTO:0001419) | PubMed (2994907) | ||
| blood (UBERON:0000178) | PubMed (2994907) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Estriol 3-sulfate 16-glucuronide (CHEBI:88727) is a steroid saponin (CHEBI:61655) |
| Synonyms | Source |
|---|---|
| (16alpha,17beta)-17-hydroxy-3-(sulfooxy)estra-1,3,5(10)-trien-16-yl-beta-D-Glucopyranosiduronic acid | HMDB |
| (16alpha,17beta)-17-hydroxy-3-(sulfooxy)estra-1,3,5(10)-trien-16-yl-beta-delta-Glucopyranosiduronic acid | HMDB |
| Estriol 3-sulfate 16alpha-glucuronide | HMDB |
| Estriol 3-sulfate 16alpha-glucuronoside | HMDB |
| (2S,3S,4S,5R)-3,4,5-trihydroxy-6-{[(1S,10R,11S,13R,14R,15S)-14-hydroxy-15-methyl-5-(sulfooxy)tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-2(7),3,5-trien-13-yl]oxy}oxane-2-carboxylic acid | HMDB |
| Estriol 3-sulphate 16-glucuronoside | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Beta-D-Glucuronides | MetaCyc |
| HMDB0010356 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:4661-65-8 | KEGG COMPOUND |
| Citations |
|---|