EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O5 |
| Net Charge | 0 |
| Average Mass | 170.120 |
| Monoisotopic Mass | 170.02152 |
| SMILES | O=C(O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C7H6O5/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| InChIKey | BRRSNXCXLSVPFC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Quercus mongolica (ncbitaxon:103485) | leaf (BTO:0000713) | PubMed (37611226) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4-trihydroxybenzoic acid (CHEBI:88714) has role plant metabolite (CHEBI:76924) |
| 2,3,4-trihydroxybenzoic acid (CHEBI:88714) has role radical scavenger (CHEBI:48578) |
| 2,3,4-trihydroxybenzoic acid (CHEBI:88714) is a monocarboxylic acid (CHEBI:25384) |
| 2,3,4-trihydroxybenzoic acid (CHEBI:88714) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 2,3,4-trihydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 4-pyrogallolcarboxylic acid | NIST Chemistry WebBook |
| 2,3,4-trihydroxybenzenecarboxylic acid | ChEBI |
| pyrogallol-4-carboxylic acid | ChEBI |
| 2,3,4-THBA | ChEBI |
| pyrogallic acid-4-carboxylic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059964 | HMDB |
| C00055642 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210807 | Reaxys |
| CAS:610-02-6 | NIST Chemistry WebBook |
| Citations |
|---|