EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 410.493 |
| Monoisotopic Mass | 410.21180 |
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2 |
| InChI | InChI=1S/C23H27FN4O2/c1-15-18(23(29)28-10-3-2-4-21(28)25-15)9-13-27-11-7-16(8-12-27)22-19-6-5-17(24)14-20(19)30-26-22/h5-6,14,16H,2-4,7-13H2,1H3 |
| InChIKey | RAPZEAPATHNIPO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risperidone (CHEBI:8871) has role antidepressant (CHEBI:35469) |
| risperidone (CHEBI:8871) has role anxiolytic drug (CHEBI:35474) |
| risperidone (CHEBI:8871) has role dopaminergic antagonist (CHEBI:48561) |
| risperidone (CHEBI:8871) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| risperidone (CHEBI:8871) has role H1-receptor antagonist (CHEBI:37955) |
| risperidone (CHEBI:8871) has role psychotropic drug (CHEBI:35471) |
| risperidone (CHEBI:8871) has role second generation antipsychotic (CHEBI:65191) |
| risperidone (CHEBI:8871) has role serotonergic antagonist (CHEBI:48279) |
| risperidone (CHEBI:8871) has role α-adrenergic antagonist (CHEBI:37890) |
| risperidone (CHEBI:8871) is a 1,2-benzoxazoles (CHEBI:51545) |
| risperidone (CHEBI:8871) is a heteroarylpiperidine (CHEBI:48585) |
| risperidone (CHEBI:8871) is a organofluorine compound (CHEBI:37143) |
| risperidone (CHEBI:8871) is a pyridopyrimidine (CHEBI:38932) |
| IUPAC Name |
|---|
| 3-{2-[4-(6-fluoro-1,2-benzisoxazol-3-yl)piperidin-1-yl]ethyl}-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one |
| INNs | Source |
|---|---|
| risperidona | ChemIDplus |
| risperidone | KEGG DRUG |
| rispéridone | WHO MedNet |
| risperidonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| LY-03004 | ChEMBL |
| LY03004 | ChEMBL |
| N05AX08 | ChEMBL |
| NSC-759895 | ChEMBL |
| Perseris | ChEMBL |
| R 64 766 | ChEMBL |
| Brand Names | Source |
|---|---|
| Okedi | ChEMBL |
| Perseris kit | ChEMBL |
| Risperdal | KEGG DRUG |
| Risperdal consta | ChEMBL |
| Risperdal consta long acting | ChEMBL |
| Risperdal m | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2389 | DrugCentral |
| D00426 | KEGG DRUG |
| DB00734 | DrugBank |
| EP196132 | Patent |
| HMDB0005020 | HMDB |
| LSM-3193 | LINCS |
| Risperidone | Wikipedia |
| US4804663 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4891881 | Reaxys |
| CAS:106266-06-2 | KEGG DRUG |
| CAS:106266-06-2 | ChemIDplus |
| Citations |
|---|