EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8871 - risperidone
| Formula | C23H27FN4O2 |
| Net Charge | 0 |
| Average Mass | 410.493 |
| Monoisotopic Mass | 410.21180 |
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2 |
| InChI | InChI=1S/C23H27FN4O2/c1-15-18(23(29)28-10-3-2-4-21(28)25-15)9-13-27-11-7-16(8-12-27)22-19-6-5-17(24)14-20(19)30-26-22/h5-6,14,16H,2-4,7-13H2,1H3 |
| InChIKey | RAPZEAPATHNIPO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risperidone (CHEBI:8871) has role dopaminergic antagonist (CHEBI:48561) |
| risperidone (CHEBI:8871) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| risperidone (CHEBI:8871) has role H1-receptor antagonist (CHEBI:37955) |
| risperidone (CHEBI:8871) has role psychotropic drug (CHEBI:35471) |
| risperidone (CHEBI:8871) has role second generation antipsychotic (CHEBI:65191) |
| risperidone (CHEBI:8871) has role serotonergic antagonist (CHEBI:48279) |
| risperidone (CHEBI:8871) has role α-adrenergic antagonist (CHEBI:37890) |
| risperidone (CHEBI:8871) is a 1,2-benzoxazoles (CHEBI:51545) |
| risperidone (CHEBI:8871) is a heteroarylpiperidine (CHEBI:48585) |
| risperidone (CHEBI:8871) is a organofluorine compound (CHEBI:37143) |
| risperidone (CHEBI:8871) is a pyridopyrimidine (CHEBI:38932) |
| IUPAC Name |
|---|
| 3-{2-[4-(6-fluoro-1,2-benzisoxazol-3-yl)piperidin-1-yl]ethyl}-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one |
| INNs | Source |
|---|---|
| risperidone | KEGG DRUG |
| risperidonum | ChemIDplus |
| risperidona | ChemIDplus |
| rispéridone | WHO MedNet |
| Synonym | Source |
|---|---|
| risperidone | IUPHAR |
| Brand Names | Source |
|---|---|
| Risperdal | KEGG DRUG |
| Risperin | DrugBank |
| Rispolept | DrugBank |
| Rispolin | DrugBank |
| Sequinan | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00426 | KEGG DRUG |
| DB00734 | DrugBank |
| EP196132 | Patent |
| US4804663 | Patent |
| Risperidone | Wikipedia |
| HMDB0005020 | HMDB |
| LSM-3193 | LINCS |
| 2389 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4891881 | Reaxys |
| CAS:106266-06-2 | KEGG DRUG |
| CAS:106266-06-2 | ChemIDplus |
| Citations |
|---|