EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8869 - Risedronic acid
| Formula | C7H11NO7P2 |
| Net Charge | 0 |
| Average Mass | 283.113 |
| Monoisotopic Mass | 283.00107 |
| SMILES | O=P(O)(O)C(O)(Cc1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | IIDJRNMFWXDHID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Risedronic acid (CHEBI:8869) has role analgesic (CHEBI:35480) |
| Risedronic acid (CHEBI:8869) has role antineoplastic agent (CHEBI:35610) |
| Risedronic acid (CHEBI:8869) has role bone density conservation agent (CHEBI:50646) |
| Risedronic acid (CHEBI:8869) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| acide risedronique | WHO MedNet |
| acido risedronico | WHO MedNet |
| Synonyms | Source |
|---|---|
| actonel | DrugCentral |
| M05BA07 | ChEMBL |
| Ridron | ChEMBL |
| Risedronate | KEGG COMPOUND |
| risedronate sodium | DrugCentral |
| risedronate sodium anhydrous | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2387 | DrugCentral |
| C08233 | KEGG COMPOUND |
| D08484 | KEGG DRUG |
| HMDB0015022 | HMDB |
| RIS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:105462-24-6 | KEGG COMPOUND |
| Citations |
|---|