EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8869 - Risedronic acid
| Formula | C7H11NO7P2 |
| Net Charge | 0 |
| Average Mass | 283.113 |
| Monoisotopic Mass | 283.00107 |
| SMILES | O=P(O)(O)C(O)(Cc1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | IIDJRNMFWXDHID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Risedronic acid (CHEBI:8869) has role analgesic (CHEBI:35480) |
| Risedronic acid (CHEBI:8869) has role antineoplastic agent (CHEBI:35610) |
| Risedronic acid (CHEBI:8869) has role bone density conservation agent (CHEBI:50646) |
| Risedronic acid (CHEBI:8869) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| acide risedronique | WHO MedNet |
| acido risedronico | WHO MedNet |
| Synonyms | Source |
|---|---|
| actonel | DrugCentral |
| M05BA07 | ChEMBL |
| Ridron | ChEMBL |
| Risedronate | KEGG COMPOUND |
| risedronate sodium | DrugCentral |
| risedronate sodium anhydrous | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2387 | DrugCentral |
| C08233 | KEGG COMPOUND |
| D08484 | KEGG DRUG |
| HMDB0015022 | HMDB |
| RIS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:105462-24-6 | KEGG COMPOUND |
| Citations |
|---|