EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H56NO7P |
| Net Charge | 0 |
| Average Mass | 549.730 |
| Monoisotopic Mass | 549.37944 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC[C@@H](O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C28H56NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(31)34-25-27(30)26-36-37(32,33)35-24-23-29(2,3)4/h12-13,27,30H,5-11,14-26H2,1-4H3/b13-12-/t27-/m1/s1 |
| InChIKey | YYSFWGQAKJTHRE-MEOKJUQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (18953024) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(11Z)-icosenoyl-sn-glycero-3-phosphocholine (CHEBI:88685) is a 1-icosenoyl-sn-glycero-3-phosphocholine (CHEBI:131982) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-[(11Z)-icos-11-enoyloxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
| Synonyms | Source |
|---|---|
| LPC(20:1n9/0:0) | HMDB |
| LysoPC(20:1n9/0:0) | HMDB |
| LyPC(20:1n9/0:0) | HMDB |
| LyPC(20:1w9/0:0) | HMDB |
| Lysophosphatidylcholine(20:1n9/0:0) | HMDB |
| LPC(20:1w9/0:0) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0010391 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29492913 | Reaxys |
| Citations |
|---|