EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10NO7P2.Na |
| Net Charge | 0 |
| Average Mass | 305.095 |
| Monoisotopic Mass | 304.98302 |
| SMILES | O=P([O-])(O)C(O)(Cc1cccnc1)P(=O)(O)O.[Na+] |
| InChI | InChI=1S/C7H11NO7P2.Na/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6;/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15);/q;+1/p-1 |
| InChIKey | DRFDPXKCEWYIAW-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | appetite enhancer A drug which increases appetite. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Risedronate sodium (CHEBI:8868) has role antineoplastic agent (CHEBI:35610) |
| Risedronate sodium (CHEBI:8868) has role appetite enhancer (CHEBI:50779) |
| Risedronate sodium (CHEBI:8868) has role bone density conservation agent (CHEBI:50646) |
| Risedronate sodium (CHEBI:8868) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| Synonyms | Source |
|---|---|
| Actonel (TN) | KEGG COMPOUND |
| NE-58095 | ChEMBL |
| NE-58095 ANHYDROUS | ChEMBL |
| NSC-722598 | ChEMBL |
| NSC-759280 | ChEMBL |
| Risedronate monosodium | ChEMBL |
| Brand Name | Source |
|---|---|
| Atelvia | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00942 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:115436-72-1 | KEGG COMPOUND |
| Citations |
|---|