EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35O2 |
| Net Charge | -1 |
| Average Mass | 307.498 |
| Monoisotopic Mass | 307.26425 |
| SMILES | [H]/C(CCCCCCCCCCCCCCC)=C([H])\C([H])=C(/[H])C(=O)[O-] |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h16-19H,2-15H2,1H3,(H,21,22)/p-1/b17-16+,19-18+ |
| InChIKey | LNAVIIOBBICBIS-NBRVCOCJSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (22308371) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihomo-linoleate (20:2n6) (CHEBI:88670) is a long-chain fatty acid (CHEBI:15904) |
| Synonyms | Source |
|---|---|
| (2E,4E)-icosa-2,4-dienoic acid | HMDB |
| Dihomo-linoleate (20:2N6) | HMDB |
| Dihomo-linoleic acid (20:2N6) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061864 | HMDB |
| Citations |
|---|