EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8866 - rimsulfuron
| Formula | C14H17N5O7S2 |
| Net Charge | 0 |
| Average Mass | 431.452 |
| Monoisotopic Mass | 431.05694 |
| SMILES | CCS(=O)(=O)c1cccnc1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C14H17N5O7S2/c1-4-27(21,22)9-6-5-7-15-12(9)28(23,24)19-14(20)18-13-16-10(25-2)8-11(17-13)26-3/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | MEFOUWRMVYJCQC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rimsulfuron (CHEBI:8866) has role environmental contaminant (CHEBI:78298) |
| rimsulfuron (CHEBI:8866) has role herbicide (CHEBI:24527) |
| rimsulfuron (CHEBI:8866) has role xenobiotic (CHEBI:35703) |
| rimsulfuron (CHEBI:8866) is a N-sulfonylurea (CHEBI:76983) |
| rimsulfuron (CHEBI:8866) is a aromatic ether (CHEBI:35618) |
| rimsulfuron (CHEBI:8866) is a pyridines (CHEBI:26421) |
| rimsulfuron (CHEBI:8866) is a pyrimidines (CHEBI:39447) |
| rimsulfuron (CHEBI:8866) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-3-(ethylsulfonyl)pyridine-2-sulfonamide |
| Manual Xrefs | Databases |
|---|---|
| C10952 | KEGG COMPOUND |
| rimsulfuron | Alan Wood's Pesticides |
| 586 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7501778 | Reaxys |
| CAS:122931-48-0 | KEGG COMPOUND |
| CAS:122931-48-0 | ChemIDplus |
| Citations |
|---|