EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O |
| Net Charge | 0 |
| Average Mass | 102.177 |
| Monoisotopic Mass | 102.10447 |
| SMILES | CCCC(O)CC |
| InChI | InChI=1S/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZOCHHNOQQHDWHG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexan-3-ol (CHEBI:88653) has role flavouring agent (CHEBI:35617) |
| hexan-3-ol (CHEBI:88653) has role pheromone (CHEBI:26013) |
| hexan-3-ol (CHEBI:88653) has role plant metabolite (CHEBI:76924) |
| hexan-3-ol (CHEBI:88653) is a hexanol (CHEBI:143552) |
| hexan-3-ol (CHEBI:88653) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| hexan-3-ol |
| Synonyms | Source |
|---|---|
| 1-ethylbutanol | ChEBI |
| 3-hexanol | ChemIDplus |
| 3-hexyl alcohol | ChemIDplus |
| ethyl propyl carbinol | ChemIDplus |
| FEMA 3351 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| hexan-3-ol | UniProt |
| Citations |
|---|