EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N.HCl |
| Net Charge | 0 |
| Average Mass | 215.768 |
| Monoisotopic Mass | 215.14408 |
| SMILES | CC(N)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12;/h8-11H,2-7,13H2,1H3;1H |
| InChIKey | OZBDFBJXRJWNAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rimantadine hydrochloride (CHEBI:8865) has role antiinfective agent (CHEBI:35441) |
| Rimantadine hydrochloride (CHEBI:8865) has role antiviral agent (CHEBI:22587) |
| Rimantadine hydrochloride (CHEBI:8865) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| EXP 126 | ChEMBL |
| EXP-126 | ChEMBL |
| NSC-206764 | ChEMBL |
| Rimantadine hydrochloride | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Flumadine | ChEMBL |
| Meradan | ChEMBL |
| Roflual | ChEMBL |
| Citations |
|---|