EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88622 - 9-Methyldodecanoic acid
| Formula | C13H26O2 |
| Net Charge | 0 |
| Average Mass | 214.349 |
| Monoisotopic Mass | 214.19328 |
| SMILES | CCCC(C)CCCCCCCC(=O)O |
| InChI | InChI=1S/C13H26O2/c1-3-9-12(2)10-7-5-4-6-8-11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | NQWYEPPIHUGBHF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Methyldodecanoic acid (CHEBI:88622) is a medium-chain fatty acid (CHEBI:59554) |
| Synonyms | Source |
|---|---|
| 9-Methyldodecanoate | HMDB |
| 9-methyldodecanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061828 | HMDB |
| Citations |
|---|