EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCCCCC(=O)OC |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-6-7-8(9)10-2/h3-7H2,1-2H3 |
| InChIKey | XNCNNDVCAUWAIT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl heptanoate (CHEBI:88620) is a fatty acid ester (CHEBI:35748) |
| Synonyms | Source |
|---|---|
| FEMA 2705 | HMDB |
| Heptanoic acid methyl ester | HMDB |
| Heptanoic acid, methyl ester | HMDB |
| Methyl enanthate | HMDB |
| Methyl ester of heptanoic acid | HMDB |
| methyl heptanoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031478 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:106-73-0 | KEGG COMPOUND |
| Citations |
|---|