EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O |
| Net Charge | 0 |
| Average Mass | 180.251 |
| Monoisotopic Mass | 180.12626 |
| SMILES | C1COC(NC(C2CC2)C2CC2)=N1 |
| InChI | InChI=1S/C10H16N2O/c1-2-7(1)9(8-3-4-8)12-10-11-5-6-13-10/h7-9H,1-6H2,(H,11,12) |
| InChIKey | CQXADFVORZEARL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rilmenidine (CHEBI:8862) has role antihypertensive agent (CHEBI:35674) |
| Rilmenidine (CHEBI:8862) is a isourea (CHEBI:48379) |
| INN | Source |
|---|---|
| rilmenidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Hyperium | ChEMBL |
| Oxaminozoline | KEGG COMPOUND |
| rilmenidene | DrugCentral |
| Rilmenidine | KEGG COMPOUND |
| rilmenidine dihydrogen phosphate | DrugCentral |
| rilmenidine phosphate | DrugCentral |
| Citations |
|---|