EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O |
| Net Charge | 0 |
| Average Mass | 110.156 |
| Monoisotopic Mass | 110.07316 |
| SMILES | CCc1ccc(C)o1 |
| InChI | InChI=1S/C7H10O/c1-3-7-5-4-6(2)8-7/h4-5H,3H2,1-2H3 |
| InChIKey | NBXLPPVOZWYADY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium avenaceum (ncbitaxon:40199) | - | PubMed (33291490) | |
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (21280206) | ||
| urine (BTO:0001419) | PubMed (29725472) | ||
| Mus musculus (ncbitaxon:10090) | urine (BTO:0001419) | PubMed (22364569) | |
| Rhodobryum giganteum (ncbitaxon:66998) | - | PubMed (19553892) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. flavouring agent A food additive that is used to added improve the taste or odour of a food. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyl-5-methylfuran (CHEBI:88617) has role flavouring agent (CHEBI:35617) |
| 2-ethyl-5-methylfuran (CHEBI:88617) has role fungal metabolite (CHEBI:76946) |
| 2-ethyl-5-methylfuran (CHEBI:88617) has role human urinary metabolite (CHEBI:84087) |
| 2-ethyl-5-methylfuran (CHEBI:88617) has role mouse metabolite (CHEBI:75771) |
| 2-ethyl-5-methylfuran (CHEBI:88617) has role plant metabolite (CHEBI:76924) |
| 2-ethyl-5-methylfuran (CHEBI:88617) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 2-ethyl-5-methylfuran |
| Synonyms | Source |
|---|---|
| 2-ethyl-5-methyl-furan | HMDB |
| 2-methyl-5-ethylfuran | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 66942 | ChemSpider |
| HMDB0029728 | HMDB |
| Citations |
|---|